C33H35N7O4 — CID 59471530
(6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(3-methyl-2H-indazol-7-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 59471530) has the molecular formula C33H35N7O4 and a molecular weight of 593.69 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(3-methyl-2H-indazol-7-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(3-methyl-2H-indazol-7-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 59471530 |
| Molecular Formula | C33H35N7O4 |
| Molecular Weight | 593.69 g/mol |
| Exact Mass | 593.28 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-[(3-methyl-2H-indazol-7-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3cccc4c(C)[nH]nc34)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C33H35N7O4/c1-3-16-38-21-30(42)39-28(17-23-12-14-26(41)15-13-23)32(43)37(19-25-10-7-11-27-22(2)35-36-31(25)27)20-29(39)40(38)33(44)34-18-24-8-5-4-6-9-24/h3-15,28-29,41H,1,16-21H2,2H3,(H,34,44)(H,35,36)/t28-,29-/m0/s1 |
| InChIKey | LVWJGRQYUUSWAT-VMPREFPWSA-N |
| XLogP | 3.31 |
| TPSA | 125.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|