C35H37ClN6O4 — CID 159906025
(6S,9aS)-N-benzyl-8-[(5-chloroquinolin-8-yl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;methane (PubChem CID 159906025) has the molecular formula C35H37ClN6O4 and a molecular weight of 641.17 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-[(5-chloroquinolin-8-yl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;methane.
| Compound Name | (6S,9aS)-N-benzyl-8-[(5-chloroquinolin-8-yl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;methane |
|---|---|
| PubChem CID | 159906025 |
| Molecular Formula | C35H37ClN6O4 |
| Molecular Weight | 641.17 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-[(5-chloroquinolin-8-yl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;methane |
| SMILES | C.C=CCN1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3ccc(Cl)c4cccnc34)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C34H33ClN6O4.CH4/c1-2-17-39-22-31(43)40-29(18-23-10-13-26(42)14-11-23)33(44)38(20-25-12-15-28(35)27-9-6-16-36-32(25)27)21-30(40)41(39)34(45)37-19-24-7-4-3-5-8-24;/h2-16,29-30,42H,1,17-22H2,(H,37,45);1H4/t29-,30-;/m0./s1 |
| InChIKey | NWOTZZATWVQTBU-PNHSAAKESA-N |
| XLogP | 4.97 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.17 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|