C37H35N7O4 — CID 59204678
(6S,9aS)-N-benzyl-8-[[2-(3-cyanophenyl)-3-pyridinyl]methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 59204678) has the molecular formula C37H35N7O4 and a molecular weight of 641.73 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-[[2-(3-cyanophenyl)-3-pyridinyl]methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-[[2-(3-cyanophenyl)-3-pyridinyl]methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 59204678 |
| Molecular Formula | C37H35N7O4 |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-[[2-(3-cyanophenyl)-3-pyridinyl]methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3cccnc3-c3cccc(C#N)c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C37H35N7O4/c1-2-18-42-25-34(46)43-32(20-26-13-15-31(45)16-14-26)36(47)41(24-33(43)44(42)37(48)40-22-27-8-4-3-5-9-27)23-30-12-7-17-39-35(30)29-11-6-10-28(19-29)21-38/h2-17,19,32-33,45H,1,18,20,22-25H2,(H,40,48)/t32-,33-/m0/s1 |
| InChIKey | SDCNKYRVDDTWNE-LQJZCPKCSA-N |
| XLogP | 4.06 |
| TPSA | 133.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|