C32H33N7O5 — CID 59567601
(6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-8-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 59567601) has the molecular formula C32H33N7O5 and a molecular weight of 595.66 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-8-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-8-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 59567601 |
| Molecular Formula | C32H33N7O5 |
| Molecular Weight | 595.66 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-8-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)methyl]-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3ccc4[nH]c(=O)[nH]c4c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H33N7O5/c1-2-14-37-20-29(41)38-27(16-21-8-11-24(40)12-9-21)30(42)36(18-23-10-13-25-26(15-23)35-31(43)34-25)19-28(38)39(37)32(44)33-17-22-6-4-3-5-7-22/h2-13,15,27-28,40H,1,14,16-20H2,(H,33,44)(H2,34,35,43)/t27-,28-/m0/s1 |
| InChIKey | OPKOHBHHWLYJJH-NSOVKSMOSA-N |
| XLogP | 2.30 |
| TPSA | 145.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.66 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|