C32H35ClN6O5 — CID 59204747
(6S,9aS)-6-[(4-aminooxyphenyl)methyl]-N-benzyl-8-[(3-chloro-4-methoxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 59204747) has the molecular formula C32H35ClN6O5 and a molecular weight of 619.12 g/mol. Its IUPAC name is (6S,9aS)-6-[(4-aminooxyphenyl)methyl]-N-benzyl-8-[(3-chloro-4-methoxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-6-[(4-aminooxyphenyl)methyl]-N-benzyl-8-[(3-chloro-4-methoxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 59204747 |
| Molecular Formula | C32H35ClN6O5 |
| Molecular Weight | 619.12 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | (6S,9aS)-6-[(4-aminooxyphenyl)methyl]-N-benzyl-8-[(3-chloro-4-methoxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2[C@@H](Cc3ccc(ON)cc3)C(=O)N(Cc3ccc(OC)c(Cl)c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H35ClN6O5/c1-3-15-37-21-30(40)38-27(17-22-9-12-25(44-34)13-10-22)31(41)36(19-24-11-14-28(43-2)26(33)16-24)20-29(38)39(37)32(42)35-18-23-7-5-4-6-8-23/h3-14,16,27,29H,1,15,17-21,34H2,2H3,(H,35,42)/t27-,29-/m0/s1 |
| InChIKey | QTTAOTKXBJGNKA-YTMVLYRLSA-N |
| XLogP | 3.34 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.12 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|