C33H35N5O6 — CID 87150933
(6S,9aS)-N-benzyl-8-[(3,4-dimethoxyphenyl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 87150933) has the molecular formula C33H35N5O6 and a molecular weight of 597.67 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-[(3,4-dimethoxyphenyl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-[(3,4-dimethoxyphenyl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 87150933 |
| Molecular Formula | C33H35N5O6 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-[(3,4-dimethoxyphenyl)methyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCN1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3ccc(OC)c(OC)c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C33H35N5O6/c1-4-16-36-22-31(40)37-27(17-23-10-13-26(39)14-11-23)32(41)35(20-25-12-15-28(43-2)29(18-25)44-3)21-30(37)38(36)33(42)34-19-24-8-6-5-7-9-24/h1,5-15,18,27,30,39H,16-17,19-22H2,2-3H3,(H,34,42)/t27-,30-/m0/s1 |
| InChIKey | GUAAGUNDIPPNCD-FIBWVYCGSA-N |
| XLogP | 2.59 |
| TPSA | 114.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|