C32H33N5O3 — CID 142956162
(6S)-N,6-dibenzyl-8-[(4-methylphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 142956162) has the molecular formula C32H33N5O3 and a molecular weight of 535.65 g/mol. Its IUPAC name is (6S)-N,6-dibenzyl-8-[(4-methylphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S)-N,6-dibenzyl-8-[(4-methylphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 142956162 |
| Molecular Formula | C32H33N5O3 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | (6S)-N,6-dibenzyl-8-[(4-methylphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCN1CC(=O)N2C(CN(Cc3ccc(C)cc3)C(=O)[C@@H]2Cc2ccccc2)N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H33N5O3/c1-3-18-35-23-30(38)36-28(19-25-10-6-4-7-11-25)31(39)34(21-27-16-14-24(2)15-17-27)22-29(36)37(35)32(40)33-20-26-12-8-5-9-13-26/h1,4-17,28-29H,18-23H2,2H3,(H,33,40)/t28-,29?/m0/s1 |
| InChIKey | DFWMWKFQLQCJRQ-XLTVJXRZSA-N |
| XLogP | 3.18 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|