C33H35N5O3S — CID 58889343
(6S,9aS)-N,6-dibenzyl-8-(2-benzylsulfanylethyl)-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58889343) has the molecular formula C33H35N5O3S and a molecular weight of 581.74 g/mol. Its IUPAC name is (6S,9aS)-N,6-dibenzyl-8-(2-benzylsulfanylethyl)-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N,6-dibenzyl-8-(2-benzylsulfanylethyl)-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58889343 |
| Molecular Formula | C33H35N5O3S |
| Molecular Weight | 581.74 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | (6S,9aS)-N,6-dibenzyl-8-(2-benzylsulfanylethyl)-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCN1CC(=O)N2[C@@H](Cc3ccccc3)C(=O)N(CCSCc3ccccc3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C33H35N5O3S/c1-2-18-36-24-31(39)37-29(21-26-12-6-3-7-13-26)32(40)35(19-20-42-25-28-16-10-5-11-17-28)23-30(37)38(36)33(41)34-22-27-14-8-4-9-15-27/h1,3-17,29-30H,18-25H2,(H,34,41)/t29-,30-/m0/s1 |
| InChIKey | IAGMWSXSBCLEAO-KYJUHHDHSA-N |
| XLogP | 3.60 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|