C33H34FN5O5 — CID 59204533
(6S)-N-benzyl-8-[2-[(2-fluorophenyl)methoxy]ethyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 59204533) has the molecular formula C33H34FN5O5 and a molecular weight of 599.66 g/mol. Its IUPAC name is (6S)-N-benzyl-8-[2-[(2-fluorophenyl)methoxy]ethyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S)-N-benzyl-8-[2-[(2-fluorophenyl)methoxy]ethyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 59204533 |
| Molecular Formula | C33H34FN5O5 |
| Molecular Weight | 599.66 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | (6S)-N-benzyl-8-[2-[(2-fluorophenyl)methoxy]ethyl]-6-[(4-hydroxyphenyl)methyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCN1CC(=O)N2C(CN(CCOCc3ccccc3F)C(=O)[C@@H]2Cc2ccc(O)cc2)N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C33H34FN5O5/c1-2-16-37-22-31(41)38-29(19-24-12-14-27(40)15-13-24)32(42)36(17-18-44-23-26-10-6-7-11-28(26)34)21-30(38)39(37)33(43)35-20-25-8-4-3-5-9-25/h1,3-15,29-30,40H,16-23H2,(H,35,43)/t29-,30?/m0/s1 |
| InChIKey | STQJMMRWFZPGQX-UFXYQILXSA-N |
| XLogP | 2.73 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.66 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|