C29H32FN5O5 — CID 88884918
(6S,9aS)-N-benzyl-8-[2-[(3-fluorophenyl)methoxy]ethyl]-4,7-dioxo-6-(2-oxopropyl)-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 88884918) has the molecular formula C29H32FN5O5 and a molecular weight of 549.60 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-[2-[(3-fluorophenyl)methoxy]ethyl]-4,7-dioxo-6-(2-oxopropyl)-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-[2-[(3-fluorophenyl)methoxy]ethyl]-4,7-dioxo-6-(2-oxopropyl)-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 88884918 |
| Molecular Formula | C29H32FN5O5 |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-[2-[(3-fluorophenyl)methoxy]ethyl]-4,7-dioxo-6-(2-oxopropyl)-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCN1CC(=O)N2[C@@H](CC(C)=O)C(=O)N(CCOCc3cccc(F)c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H32FN5O5/c1-3-12-33-19-27(37)34-25(15-21(2)36)28(38)32(13-14-40-20-23-10-7-11-24(30)16-23)18-26(34)35(33)29(39)31-17-22-8-5-4-6-9-22/h1,4-11,16,25-26H,12-15,17-20H2,2H3,(H,31,39)/t25-,26-/m0/s1 |
| InChIKey | RBGAKWPMBHKKDN-UIOOFZCWSA-N |
| XLogP | 1.76 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|