C28H29N5O4 — CID 58888550
(6S,9aS)-N-benzyl-4,7-dioxo-6-phenyl-8-(2-prop-2-ynoxyethyl)-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58888550) has the molecular formula C28H29N5O4 and a molecular weight of 499.57 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-4,7-dioxo-6-phenyl-8-(2-prop-2-ynoxyethyl)-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-4,7-dioxo-6-phenyl-8-(2-prop-2-ynoxyethyl)-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58888550 |
| Molecular Formula | C28H29N5O4 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | (6S,9aS)-N-benzyl-4,7-dioxo-6-phenyl-8-(2-prop-2-ynoxyethyl)-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCOCCN1C[C@H]2N(C(=O)CN(CC#C)N2C(=O)NCc2ccccc2)[C@@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C28H29N5O4/c1-3-15-31-21-25(34)32-24(33(31)28(36)29-19-22-11-7-5-8-12-22)20-30(16-18-37-17-4-2)27(35)26(32)23-13-9-6-10-14-23/h1-2,5-14,24,26H,15-21H2,(H,29,36)/t24-,26-/m0/s1 |
| InChIKey | IFLDJUCVJHFGRM-AHWVRZQESA-N |
| XLogP | 1.45 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|