C30H28ClN5O3 — CID 58889497
(6S,9aS)-N-benzyl-8-[(3-chlorophenyl)methyl]-4,7-dioxo-6-phenyl-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58889497) has the molecular formula C30H28ClN5O3 and a molecular weight of 542.04 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-[(3-chlorophenyl)methyl]-4,7-dioxo-6-phenyl-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-[(3-chlorophenyl)methyl]-4,7-dioxo-6-phenyl-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58889497 |
| Molecular Formula | C30H28ClN5O3 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-[(3-chlorophenyl)methyl]-4,7-dioxo-6-phenyl-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCN1CC(=O)N2[C@@H](c3ccccc3)C(=O)N(Cc3cccc(Cl)c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C30H28ClN5O3/c1-2-16-34-21-27(37)35-26(36(34)30(39)32-18-22-10-5-3-6-11-22)20-33(19-23-12-9-15-25(31)17-23)29(38)28(35)24-13-7-4-8-14-24/h1,3-15,17,26,28H,16,18-21H2,(H,32,39)/t26-,28-/m0/s1 |
| InChIKey | RHZWWBKKUJGQNK-XCZPVHLTSA-N |
| XLogP | 3.65 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|