C28H32BN5O3 — CID 89032735
CID 89032735 (PubChem CID 89032735) has the molecular formula C28H32BN5O3 and a molecular weight of 497.41 g/mol.
| Compound Name | CID 89032735 |
|---|---|
| PubChem CID | 89032735 |
| Molecular Formula | C28H32BN5O3 |
| Molecular Weight | 497.41 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(CN2C[C@H]3N(C(=O)CN(CC#C)N3C(=O)NCc3ccccc3)[C@@H](CC(C)C)C2=O)c1 |
| InChI | InChI=1S/C28H32BN5O3/c1-4-13-32-19-26(35)33-24(14-20(2)3)27(36)31(17-22-11-8-12-23(29)15-22)18-25(33)34(32)28(37)30-16-21-9-6-5-7-10-21/h1,5-12,15,20,24-25H,13-14,16-19H2,2-3H3,(H,30,37)/t24-,25-/m0/s1 |
| InChIKey | CGNBHBZFULKMNG-DQEYMECFSA-N |
| XLogP | 1.47 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|