C32H35N5O3 — CID 58889893
(6S,9aS)-N-benzyl-6-(2-methylpropyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58889893) has the molecular formula C32H35N5O3 and a molecular weight of 537.66 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-(2-methylpropyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-(2-methylpropyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58889893 |
| Molecular Formula | C32H35N5O3 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-(2-methylpropyl)-8-(naphthalen-1-ylmethyl)-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCN1CC(=O)N2[C@@H](CC(C)C)C(=O)N(Cc3cccc4ccccc34)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C32H35N5O3/c1-4-17-35-22-30(38)36-28(18-23(2)3)31(39)34(20-26-15-10-14-25-13-8-9-16-27(25)26)21-29(36)37(35)32(40)33-19-24-11-6-5-7-12-24/h1,5-16,23,28-29H,17-22H2,2-3H3,(H,33,40)/t28-,29-/m0/s1 |
| InChIKey | ODTWAQLKTDAUNC-VMPREFPWSA-N |
| XLogP | 3.83 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|