C29H32F3N5O3 — CID 58889931
(6S,9aS)-N-benzyl-6-butyl-4,7-dioxo-2-prop-2-ynyl-8-[[3-(trifluoromethyl)phenyl]methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58889931) has the molecular formula C29H32F3N5O3 and a molecular weight of 555.60 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-butyl-4,7-dioxo-2-prop-2-ynyl-8-[[3-(trifluoromethyl)phenyl]methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-butyl-4,7-dioxo-2-prop-2-ynyl-8-[[3-(trifluoromethyl)phenyl]methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58889931 |
| Molecular Formula | C29H32F3N5O3 |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-butyl-4,7-dioxo-2-prop-2-ynyl-8-[[3-(trifluoromethyl)phenyl]methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCN1CC(=O)N2[C@@H](CCCC)C(=O)N(Cc3cccc(C(F)(F)F)c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C29H32F3N5O3/c1-3-5-14-24-27(39)34(18-22-12-9-13-23(16-22)29(30,31)32)19-25-36(24)26(38)20-35(15-4-2)37(25)28(40)33-17-21-10-7-6-8-11-21/h2,6-13,16,24-25H,3,5,14-15,17-20H2,1H3,(H,33,40)/t24-,25-/m0/s1 |
| InChIKey | UBKNJHCQGVBMPT-DQEYMECFSA-N |
| XLogP | 3.84 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|