C26H37N5O3 — CID 58889269
(6S,9aS)-N-benzyl-6-butyl-4,7-dioxo-8-pentan-3-yl-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58889269) has the molecular formula C26H37N5O3 and a molecular weight of 467.61 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-butyl-4,7-dioxo-8-pentan-3-yl-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-butyl-4,7-dioxo-8-pentan-3-yl-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58889269 |
| Molecular Formula | C26H37N5O3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.29 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-butyl-4,7-dioxo-8-pentan-3-yl-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCN1CC(=O)N2[C@@H](CCCC)C(=O)N(C(CC)CC)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H37N5O3/c1-5-9-15-22-25(33)29(21(7-3)8-4)18-23-30(22)24(32)19-28(16-6-2)31(23)26(34)27-17-20-13-11-10-12-14-20/h2,10-14,21-23H,5,7-9,15-19H2,1,3-4H3,(H,27,34)/t22-,23-/m0/s1 |
| InChIKey | MPMZWTLYIDRTJW-GOTSBHOMSA-N |
| XLogP | 2.81 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|