C24H33N5O4S — CID 88871047
(6S,9aS)-N-benzyl-2-ethyl-6-(2-methylsulfanylethyl)-4,7-dioxo-8-(2-prop-2-ynoxyethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 88871047) has the molecular formula C24H33N5O4S and a molecular weight of 487.63 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-2-ethyl-6-(2-methylsulfanylethyl)-4,7-dioxo-8-(2-prop-2-ynoxyethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-2-ethyl-6-(2-methylsulfanylethyl)-4,7-dioxo-8-(2-prop-2-ynoxyethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 88871047 |
| Molecular Formula | C24H33N5O4S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | (6S,9aS)-N-benzyl-2-ethyl-6-(2-methylsulfanylethyl)-4,7-dioxo-8-(2-prop-2-ynoxyethyl)-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCOCCN1C[C@H]2N(C(=O)CN(CC)N2C(=O)NCc2ccccc2)[C@@H](CCSC)C1=O |
| InChI | InChI=1S/C24H33N5O4S/c1-4-13-33-14-12-26-17-21-28(20(23(26)31)11-15-34-3)22(30)18-27(5-2)29(21)24(32)25-16-19-9-7-6-8-10-19/h1,6-10,20-21H,5,11-18H2,2-3H3,(H,25,32)/t20-,21-/m0/s1 |
| InChIKey | WATHWDNOTRUXSH-SFTDATJTSA-N |
| XLogP | 1.22 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|