C28H30FN5O6 — CID 58889850
2-[(6S,9aS)-1-(benzylcarbamoyl)-8-[2-[(4-fluorophenyl)methoxy]ethyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid (PubChem CID 58889850) has the molecular formula C28H30FN5O6 and a molecular weight of 551.58 g/mol. Its IUPAC name is 2-[(6S,9aS)-1-(benzylcarbamoyl)-8-[2-[(4-fluorophenyl)methoxy]ethyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid.
| Compound Name | 2-[(6S,9aS)-1-(benzylcarbamoyl)-8-[2-[(4-fluorophenyl)methoxy]ethyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid |
|---|---|
| PubChem CID | 58889850 |
| Molecular Formula | C28H30FN5O6 |
| Molecular Weight | 551.58 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 2-[(6S,9aS)-1-(benzylcarbamoyl)-8-[2-[(4-fluorophenyl)methoxy]ethyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]acetic acid |
| SMILES | C#CCN1CC(=O)N2[C@@H](CC(=O)O)C(=O)N(CCOCc3ccc(F)cc3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C28H30FN5O6/c1-2-12-32-18-25(35)33-23(15-26(36)37)27(38)31(13-14-40-19-21-8-10-22(29)11-9-21)17-24(33)34(32)28(39)30-16-20-6-4-3-5-7-20/h1,3-11,23-24H,12-19H2,(H,30,39)(H,36,37)/t23-,24-/m0/s1 |
| InChIKey | XSXWPSINIMZZCQ-ZEQRLZLVSA-N |
| XLogP | 1.26 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.58 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|