C34H41N5O5 — CID 66788149
(6S,9aS)-N,6-dibenzyl-8-[2-(3,4-dimethoxyphenyl)ethyl]-4,7-dioxo-2-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 66788149) has the molecular formula C34H41N5O5 and a molecular weight of 599.73 g/mol. Its IUPAC name is (6S,9aS)-N,6-dibenzyl-8-[2-(3,4-dimethoxyphenyl)ethyl]-4,7-dioxo-2-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N,6-dibenzyl-8-[2-(3,4-dimethoxyphenyl)ethyl]-4,7-dioxo-2-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 66788149 |
| Molecular Formula | C34H41N5O5 |
| Molecular Weight | 599.73 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | (6S,9aS)-N,6-dibenzyl-8-[2-(3,4-dimethoxyphenyl)ethyl]-4,7-dioxo-2-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CCCN1CC(=O)N2[C@@H](Cc3ccccc3)C(=O)N(CCc3ccc(OC)c(OC)c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C34H41N5O5/c1-4-18-37-24-32(40)38-28(20-25-11-7-5-8-12-25)33(41)36(19-17-26-15-16-29(43-2)30(21-26)44-3)23-31(38)39(37)34(42)35-22-27-13-9-6-10-14-27/h5-16,21,28,31H,4,17-20,22-24H2,1-3H3,(H,35,42)/t28-,31-/m0/s1 |
| InChIKey | BFONYYOCVFYELV-IZEXYCQBSA-N |
| XLogP | 3.71 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |