C25H29N5O4 — CID 143145140
N-benzyl-8-[(4-methoxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 143145140) has the molecular formula C25H29N5O4 and a molecular weight of 463.54 g/mol. Its IUPAC name is N-benzyl-8-[(4-methoxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | N-benzyl-8-[(4-methoxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 143145140 |
| Molecular Formula | C25H29N5O4 |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | N-benzyl-8-[(4-methoxyphenyl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2CC(=O)N(Cc3ccc(OC)cc3)CC2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C25H29N5O4/c1-3-13-28-17-24(32)29-18-23(31)27(15-20-9-11-21(34-2)12-10-20)16-22(29)30(28)25(33)26-14-19-7-5-4-6-8-19/h3-12,22H,1,13-18H2,2H3,(H,26,33) |
| InChIKey | NTLGSJSLQMLBSU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|