C26H30N8O3 — CID 126496450
(6S,9aS)-N-benzyl-6-methyl-8-[(3-methylbenzotriazol-5-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 126496450) has the molecular formula C26H30N8O3 and a molecular weight of 502.58 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-6-methyl-8-[(3-methylbenzotriazol-5-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-6-methyl-8-[(3-methylbenzotriazol-5-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 126496450 |
| Molecular Formula | C26H30N8O3 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | (6S,9aS)-N-benzyl-6-methyl-8-[(3-methylbenzotriazol-5-yl)methyl]-4,7-dioxo-2-prop-2-enyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C=CCN1CC(=O)N2[C@@H](C)C(=O)N(Cc3ccc4nnn(C)c4c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H30N8O3/c1-4-12-32-17-24(35)33-18(2)25(36)31(15-20-10-11-21-22(13-20)30(3)29-28-21)16-23(33)34(32)26(37)27-14-19-8-6-5-7-9-19/h4-11,13,18,23H,1,12,14-17H2,2-3H3,(H,27,37)/t18-,23-/m0/s1 |
| InChIKey | PQXFIKPRJPSQDI-MBSDFSHPSA-N |
| XLogP | 1.48 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|