C31H32N8O3 — CID 89305584
1-[(5S,8aS)-7-[(1-methylbenzotriazol-5-yl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea (PubChem CID 89305584) has the molecular formula C31H32N8O3 and a molecular weight of 564.65 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(1-methylbenzotriazol-5-yl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea.
| Compound Name | 1-[(5S,8aS)-7-[(1-methylbenzotriazol-5-yl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89305584 |
| Molecular Formula | C31H32N8O3 |
| Molecular Weight | 564.65 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | 1-[(5S,8aS)-7-[(1-methylbenzotriazol-5-yl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](c3ccccc3)C(=O)N(Cc3ccc4c(c3)nnn4C)C[C@@H]21 |
| InChI | InChI=1S/C31H32N8O3/c1-3-16-37(31(42)32-18-22-10-6-4-7-11-22)38-21-28(40)39-27(38)20-36(30(41)29(39)24-12-8-5-9-13-24)19-23-14-15-26-25(17-23)33-34-35(26)2/h3-15,17,27,29H,1,16,18-21H2,2H3,(H,32,42)/t27-,29+/m1/s1 |
| InChIKey | KWCVUQGFVPOYPL-PXJZQJOASA-N |
| XLogP | 2.83 |
| TPSA | 106.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.65 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|