C33H31ClN6O3 — CID 89305548
1-[(5S,8aS)-7-[(7-chloroquinolin-8-yl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea (PubChem CID 89305548) has the molecular formula C33H31ClN6O3 and a molecular weight of 595.10 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(7-chloroquinolin-8-yl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea.
| Compound Name | 1-[(5S,8aS)-7-[(7-chloroquinolin-8-yl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89305548 |
| Molecular Formula | C33H31ClN6O3 |
| Molecular Weight | 595.10 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | 1-[(5S,8aS)-7-[(7-chloroquinolin-8-yl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](c3ccccc3)C(=O)N(Cc3c(Cl)ccc4cccnc34)C[C@@H]21 |
| InChI | InChI=1S/C33H31ClN6O3/c1-2-18-38(33(43)36-19-23-10-5-3-6-11-23)39-22-29(41)40-28(39)21-37(32(42)31(40)25-12-7-4-8-13-25)20-26-27(34)16-15-24-14-9-17-35-30(24)26/h2-17,28,31H,1,18-22H2,(H,36,43)/t28-,31+/m1/s1 |
| InChIKey | DHHNOYCMSSTUFH-MVSFAKPFSA-N |
| XLogP | 4.75 |
| TPSA | 89.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.10 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|