C31H29ClN6O4 — CID 71132999
1-[(5S,8aS)-7-[(7-chloroquinolin-8-yl)methyl]-5-(3-hydroxyphenyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea (PubChem CID 71132999) has the molecular formula C31H29ClN6O4 and a molecular weight of 585.06 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(7-chloroquinolin-8-yl)methyl]-5-(3-hydroxyphenyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea.
| Compound Name | 1-[(5S,8aS)-7-[(7-chloroquinolin-8-yl)methyl]-5-(3-hydroxyphenyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
|---|---|
| PubChem CID | 71132999 |
| Molecular Formula | C31H29ClN6O4 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 1-[(5S,8aS)-7-[(7-chloroquinolin-8-yl)methyl]-5-(3-hydroxyphenyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
| SMILES | CN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](c3cccc(O)c3)C(=O)N(Cc3c(Cl)ccc4cccnc34)C[C@@H]21 |
| InChI | InChI=1S/C31H29ClN6O4/c1-35(31(42)34-16-20-7-3-2-4-8-20)37-19-27(40)38-26(37)18-36(30(41)29(38)22-9-5-11-23(39)15-22)17-24-25(32)13-12-21-10-6-14-33-28(21)24/h2-15,26,29,39H,16-19H2,1H3,(H,34,42)/t26-,29+/m1/s1 |
| InChIKey | HSNCPISRRAJFHN-UHSQPCAPSA-N |
| XLogP | 3.90 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |