C29H28N6O3S — CID 70993265
1-[(5S,8aS)-7-(1,3-benzothiazol-4-ylmethyl)-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea (PubChem CID 70993265) has the molecular formula C29H28N6O3S and a molecular weight of 540.65 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-(1,3-benzothiazol-4-ylmethyl)-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea.
| Compound Name | 1-[(5S,8aS)-7-(1,3-benzothiazol-4-ylmethyl)-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
|---|---|
| PubChem CID | 70993265 |
| Molecular Formula | C29H28N6O3S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | 1-[(5S,8aS)-7-(1,3-benzothiazol-4-ylmethyl)-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
| SMILES | CN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](c3ccccc3)C(=O)N(Cc3cccc4scnc34)C[C@@H]21 |
| InChI | InChI=1S/C29H28N6O3S/c1-32(29(38)30-15-20-9-4-2-5-10-20)34-18-25(36)35-24(34)17-33(28(37)27(35)21-11-6-3-7-12-21)16-22-13-8-14-23-26(22)31-19-39-23/h2-14,19,24,27H,15-18H2,1H3,(H,30,38)/t24-,27+/m1/s1 |
| InChIKey | XPOBYJOWVLGVNP-SQHAQQRYSA-N |
| XLogP | 3.61 |
| TPSA | 89.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |