C30H31N7O3S — CID 89305551
1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-benzyl-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea (PubChem CID 89305551) has the molecular formula C30H31N7O3S and a molecular weight of 569.69 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-benzyl-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea.
| Compound Name | 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-benzyl-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
|---|---|
| PubChem CID | 89305551 |
| Molecular Formula | C30H31N7O3S |
| Molecular Weight | 569.69 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-benzyl-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
| SMILES | CN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](Cc3ccccc3)C(=O)N(Cc3cccc4sc(N)nc34)C[C@@H]21 |
| InChI | InChI=1S/C30H31N7O3S/c1-34(30(40)32-16-21-11-6-3-7-12-21)36-19-26(38)37-23(15-20-9-4-2-5-10-20)28(39)35(18-25(36)37)17-22-13-8-14-24-27(22)33-29(31)41-24/h2-14,23,25H,15-19H2,1H3,(H2,31,33)(H,32,40)/t23-,25+/m0/s1 |
| InChIKey | JFUQZTKUCIASPC-UKILVPOCSA-N |
| XLogP | 3.06 |
| TPSA | 115.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.69 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |