C30H33N5O3 — CID 70993214
1-[(5S,8aS)-5-benzyl-7-[(2-methylphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea (PubChem CID 70993214) has the molecular formula C30H33N5O3 and a molecular weight of 511.63 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-benzyl-7-[(2-methylphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea.
| Compound Name | 1-[(5S,8aS)-5-benzyl-7-[(2-methylphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
|---|---|
| PubChem CID | 70993214 |
| Molecular Formula | C30H33N5O3 |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 1-[(5S,8aS)-5-benzyl-7-[(2-methylphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
| SMILES | Cc1ccccc1CN1C[C@H]2N(C(=O)CN2N(C)C(=O)NCc2ccccc2)[C@@H](Cc2ccccc2)C1=O |
| InChI | InChI=1S/C30H33N5O3/c1-22-11-9-10-16-25(22)19-33-20-27-34(32(2)30(38)31-18-24-14-7-4-8-15-24)21-28(36)35(27)26(29(33)37)17-23-12-5-3-6-13-23/h3-16,26-27H,17-21H2,1-2H3,(H,31,38)/t26-,27+/m0/s1 |
| InChIKey | XSKSERBJWOZQGL-RRPNLBNLSA-N |
| XLogP | 3.18 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |