C34H35N5O6 — CID 16725771
1-[(5S,8aS)-5-[(3,4-dihydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-methoxyphenyl)methyl]-1-methylurea (PubChem CID 16725771) has the molecular formula C34H35N5O6 and a molecular weight of 609.68 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-[(3,4-dihydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-methoxyphenyl)methyl]-1-methylurea.
| Compound Name | 1-[(5S,8aS)-5-[(3,4-dihydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-methoxyphenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 16725771 |
| Molecular Formula | C34H35N5O6 |
| Molecular Weight | 609.68 g/mol |
| Exact Mass | 609.26 |
| IUPAC Name | 1-[(5S,8aS)-5-[(3,4-dihydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-methoxyphenyl)methyl]-1-methylurea |
| SMILES | COc1ccc(CNC(=O)N(C)N2CC(=O)N3[C@@H](Cc4ccc(O)c(O)c4)C(=O)N(Cc4cccc5ccccc45)C[C@@H]32)cc1 |
| InChI | InChI=1S/C34H35N5O6/c1-36(34(44)35-18-22-10-13-26(45-2)14-11-22)38-21-32(42)39-28(16-23-12-15-29(40)30(41)17-23)33(43)37(20-31(38)39)19-25-8-5-7-24-6-3-4-9-27(24)25/h3-15,17,28,31,40-41H,16,18-21H2,1-2H3,(H,35,44)/t28-,31+/m0/s1 |
| InChIKey | MTALHMIHILRAFM-QCENPCRXSA-N |
| XLogP | 3.44 |
| TPSA | 125.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|