C28H32N6O3 — CID 71132981
1-[(5S,8aS)-5-[[4-(methylamino)phenyl]methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1,3-dimethylurea (PubChem CID 71132981) has the molecular formula C28H32N6O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-[[4-(methylamino)phenyl]methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1,3-dimethylurea.
| Compound Name | 1-[(5S,8aS)-5-[[4-(methylamino)phenyl]methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 71132981 |
| Molecular Formula | C28H32N6O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 1-[(5S,8aS)-5-[[4-(methylamino)phenyl]methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)N1CC(=O)N2[C@@H](Cc3ccc(NC)cc3)C(=O)N(Cc3cccc4ccccc34)C[C@@H]21 |
| InChI | InChI=1S/C28H32N6O3/c1-29-22-13-11-19(12-14-22)15-24-27(36)32(16-21-9-6-8-20-7-4-5-10-23(20)21)17-25-33(18-26(35)34(24)25)31(3)28(37)30-2/h4-14,24-25,29H,15-18H2,1-3H3,(H,30,37)/t24-,25+/m0/s1 |
| InChIKey | ZLVSZLZWBSVALQ-LOSJGSFVSA-N |
| XLogP | 2.49 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |