C26H27N5O3 — CID 16657501
1-[(5S,8aS)-7-(naphthalen-1-ylmethyl)-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1,3-dimethylurea (PubChem CID 16657501) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-(naphthalen-1-ylmethyl)-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1,3-dimethylurea.
| Compound Name | 1-[(5S,8aS)-7-(naphthalen-1-ylmethyl)-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 16657501 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 1-[(5S,8aS)-7-(naphthalen-1-ylmethyl)-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)N1CC(=O)N2[C@@H](c3ccccc3)C(=O)N(Cc3cccc4ccccc34)C[C@@H]21 |
| InChI | InChI=1S/C26H27N5O3/c1-27-26(34)28(2)30-17-23(32)31-22(30)16-29(25(33)24(31)19-10-4-3-5-11-19)15-20-13-8-12-18-9-6-7-14-21(18)20/h3-14,22,24H,15-17H2,1-2H3,(H,27,34)/t22-,24+/m1/s1 |
| InChIKey | RPDRORCLSYEOGO-VWNXMTODSA-N |
| XLogP | 2.58 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |