C30H33N5O5 — CID 71137676
1-[(5S,8aS)-7-[(3,4-dimethoxyphenyl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea (PubChem CID 71137676) has the molecular formula C30H33N5O5 and a molecular weight of 543.62 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(3,4-dimethoxyphenyl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea.
| Compound Name | 1-[(5S,8aS)-7-[(3,4-dimethoxyphenyl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
|---|---|
| PubChem CID | 71137676 |
| Molecular Formula | C30H33N5O5 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 1-[(5S,8aS)-7-[(3,4-dimethoxyphenyl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
| SMILES | COc1ccc(CN2C[C@H]3N(C(=O)CN3N(C)C(=O)NCc3ccccc3)[C@@H](c3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C30H33N5O5/c1-32(30(38)31-17-21-10-6-4-7-11-21)34-20-27(36)35-26(34)19-33(29(37)28(35)23-12-8-5-9-13-23)18-22-14-15-24(39-2)25(16-22)40-3/h4-16,26,28H,17-20H2,1-3H3,(H,31,38)/t26-,28+/m1/s1 |
| InChIKey | LMRYMXQQXVBNID-IAPPQJPRSA-N |
| XLogP | 3.01 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |