C28H27Cl2N5O3 — CID 71189375
1-[(5S,8aS)-7-[(3,4-dichlorophenyl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea (PubChem CID 71189375) has the molecular formula C28H27Cl2N5O3 and a molecular weight of 552.46 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(3,4-dichlorophenyl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea.
| Compound Name | 1-[(5S,8aS)-7-[(3,4-dichlorophenyl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
|---|---|
| PubChem CID | 71189375 |
| Molecular Formula | C28H27Cl2N5O3 |
| Molecular Weight | 552.46 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 1-[(5S,8aS)-7-[(3,4-dichlorophenyl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
| SMILES | CN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](c3ccccc3)C(=O)N(Cc3ccc(Cl)c(Cl)c3)C[C@@H]21 |
| InChI | InChI=1S/C28H27Cl2N5O3/c1-32(28(38)31-15-19-8-4-2-5-9-19)34-18-25(36)35-24(34)17-33(16-20-12-13-22(29)23(30)14-20)27(37)26(35)21-10-6-3-7-11-21/h2-14,24,26H,15-18H2,1H3,(H,31,38)/t24-,26+/m1/s1 |
| InChIKey | KCRZIHNQSSBQEQ-RSXGOPAZSA-N |
| XLogP | 4.30 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |