C29H28F3N5O3 — CID 71132337
1-[(5S,8aS)-5-benzyl-3,6-dioxo-7-[(3,4,5-trifluorophenyl)methyl]-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea (PubChem CID 71132337) has the molecular formula C29H28F3N5O3 and a molecular weight of 551.57 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-benzyl-3,6-dioxo-7-[(3,4,5-trifluorophenyl)methyl]-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea.
| Compound Name | 1-[(5S,8aS)-5-benzyl-3,6-dioxo-7-[(3,4,5-trifluorophenyl)methyl]-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
|---|---|
| PubChem CID | 71132337 |
| Molecular Formula | C29H28F3N5O3 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 1-[(5S,8aS)-5-benzyl-3,6-dioxo-7-[(3,4,5-trifluorophenyl)methyl]-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
| SMILES | CN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](Cc3ccccc3)C(=O)N(Cc3cc(F)c(F)c(F)c3)C[C@@H]21 |
| InChI | InChI=1S/C29H28F3N5O3/c1-34(29(40)33-15-20-10-6-3-7-11-20)36-18-26(38)37-24(14-19-8-4-2-5-9-19)28(39)35(17-25(36)37)16-21-12-22(30)27(32)23(31)13-21/h2-13,24-25H,14-18H2,1H3,(H,33,40)/t24-,25+/m0/s1 |
| InChIKey | TTYMMJNTNJMZKV-LOSJGSFVSA-N |
| XLogP | 3.28 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|