C29H30FN5O4 — CID 70993163
1-[(5S,8aS)-7-[(3-fluorophenyl)methyl]-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea (PubChem CID 70993163) has the molecular formula C29H30FN5O4 and a molecular weight of 531.59 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(3-fluorophenyl)methyl]-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea.
| Compound Name | 1-[(5S,8aS)-7-[(3-fluorophenyl)methyl]-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
|---|---|
| PubChem CID | 70993163 |
| Molecular Formula | C29H30FN5O4 |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | 1-[(5S,8aS)-7-[(3-fluorophenyl)methyl]-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
| SMILES | CN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3cccc(F)c3)C[C@@H]21 |
| InChI | InChI=1S/C29H30FN5O4/c1-32(29(39)31-16-21-6-3-2-4-7-21)34-19-27(37)35-25(15-20-10-12-24(36)13-11-20)28(38)33(18-26(34)35)17-22-8-5-9-23(30)14-22/h2-14,25-26,36H,15-19H2,1H3,(H,31,39)/t25-,26+/m0/s1 |
| InChIKey | HCIUQGAOFQYLSI-IZZNHLLZSA-N |
| XLogP | 2.71 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |