C33H32FN5O3 — CID 16725423
1-[(5S,8aS)-5-benzyl-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-methylurea (PubChem CID 16725423) has the molecular formula C33H32FN5O3 and a molecular weight of 565.65 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-benzyl-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-methylurea.
| Compound Name | 1-[(5S,8aS)-5-benzyl-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 16725423 |
| Molecular Formula | C33H32FN5O3 |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.25 |
| IUPAC Name | 1-[(5S,8aS)-5-benzyl-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-methylurea |
| SMILES | CN(C(=O)NCc1ccc(F)cc1)N1CC(=O)N2[C@@H](Cc3ccccc3)C(=O)N(Cc3cccc4ccccc34)C[C@@H]21 |
| InChI | InChI=1S/C33H32FN5O3/c1-36(33(42)35-19-24-14-16-27(34)17-15-24)38-22-31(40)39-29(18-23-8-3-2-4-9-23)32(41)37(21-30(38)39)20-26-12-7-11-25-10-5-6-13-28(25)26/h2-17,29-30H,18-22H2,1H3,(H,35,42)/t29-,30+/m0/s1 |
| InChIKey | LPFZZNJQTCSKTF-XZWHSSHBSA-N |
| XLogP | 4.16 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |