C29H29F2N5O4 — CID 70993123
1-[(5S,8aS)-7-[(2,5-difluorophenyl)methyl]-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea (PubChem CID 70993123) has the molecular formula C29H29F2N5O4 and a molecular weight of 549.58 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(2,5-difluorophenyl)methyl]-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea.
| Compound Name | 1-[(5S,8aS)-7-[(2,5-difluorophenyl)methyl]-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
|---|---|
| PubChem CID | 70993123 |
| Molecular Formula | C29H29F2N5O4 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 1-[(5S,8aS)-7-[(2,5-difluorophenyl)methyl]-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-methylurea |
| SMILES | CN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3cc(F)ccc3F)C[C@@H]21 |
| InChI | InChI=1S/C29H29F2N5O4/c1-33(29(40)32-15-20-5-3-2-4-6-20)35-18-27(38)36-25(13-19-7-10-23(37)11-8-19)28(39)34(17-26(35)36)16-21-14-22(30)9-12-24(21)31/h2-12,14,25-26,37H,13,15-18H2,1H3,(H,32,40)/t25-,26+/m0/s1 |
| InChIKey | NSQXOQAFAQSLSX-IZZNHLLZSA-N |
| XLogP | 2.85 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |