C33H33N5O4 — CID 71194538
3-benzyl-1-[(5S)-5-[(4-hydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-methylurea (PubChem CID 71194538) has the molecular formula C33H33N5O4 and a molecular weight of 563.66 g/mol. Its IUPAC name is 3-benzyl-1-[(5S)-5-[(4-hydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-methylurea.
| Compound Name | 3-benzyl-1-[(5S)-5-[(4-hydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-methylurea |
|---|---|
| PubChem CID | 71194538 |
| Molecular Formula | C33H33N5O4 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.25 |
| IUPAC Name | 3-benzyl-1-[(5S)-5-[(4-hydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-1-methylurea |
| SMILES | CN(C(=O)NCc1ccccc1)N1CC(=O)N2C1CN(Cc1cccc3ccccc13)C(=O)[C@@H]2Cc1ccc(O)cc1 |
| InChI | InChI=1S/C33H33N5O4/c1-35(33(42)34-19-24-8-3-2-4-9-24)37-22-31(40)38-29(18-23-14-16-27(39)17-15-23)32(41)36(21-30(37)38)20-26-12-7-11-25-10-5-6-13-28(25)26/h2-17,29-30,39H,18-22H2,1H3,(H,34,42)/t29-,30?/m0/s1 |
| InChIKey | MHOOWHMHRKUEKT-UFXYQILXSA-N |
| XLogP | 3.73 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |