C33H40N6O4 — CID 71132347
1-[(5S,8aS)-7-[[2-(dimethylamino)phenyl]methyl]-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-propylurea (PubChem CID 71132347) has the molecular formula C33H40N6O4 and a molecular weight of 584.72 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[[2-(dimethylamino)phenyl]methyl]-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-propylurea.
| Compound Name | 1-[(5S,8aS)-7-[[2-(dimethylamino)phenyl]methyl]-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-propylurea |
|---|---|
| PubChem CID | 71132347 |
| Molecular Formula | C33H40N6O4 |
| Molecular Weight | 584.72 g/mol |
| Exact Mass | 584.31 |
| IUPAC Name | 1-[(5S,8aS)-7-[[2-(dimethylamino)phenyl]methyl]-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-propylurea |
| SMILES | CCCN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3ccccc3N(C)C)C[C@@H]21 |
| InChI | InChI=1S/C33H40N6O4/c1-4-18-37(33(43)34-20-25-10-6-5-7-11-25)38-23-31(41)39-29(19-24-14-16-27(40)17-15-24)32(42)36(22-30(38)39)21-26-12-8-9-13-28(26)35(2)3/h5-17,29-30,40H,4,18-23H2,1-3H3,(H,34,43)/t29-,30+/m0/s1 |
| InChIKey | FIWGJDDAWLXBEU-XZWHSSHBSA-N |
| XLogP | 3.42 |
| TPSA | 99.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.72 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |