C33H38N6O3 — CID 89168754
1-[(5S,8aS)-5-benzyl-7-[[2-(dimethylamino)phenyl]methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea (PubChem CID 89168754) has the molecular formula C33H38N6O3 and a molecular weight of 566.71 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-benzyl-7-[[2-(dimethylamino)phenyl]methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea.
| Compound Name | 1-[(5S,8aS)-5-benzyl-7-[[2-(dimethylamino)phenyl]methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89168754 |
| Molecular Formula | C33H38N6O3 |
| Molecular Weight | 566.71 g/mol |
| Exact Mass | 566.30 |
| IUPAC Name | 1-[(5S,8aS)-5-benzyl-7-[[2-(dimethylamino)phenyl]methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](Cc3ccccc3)C(=O)N(Cc3ccccc3N(C)C)C[C@@H]21 |
| InChI | InChI=1S/C33H38N6O3/c1-4-19-37(33(42)34-21-26-15-9-6-10-16-26)38-24-31(40)39-29(20-25-13-7-5-8-14-25)32(41)36(23-30(38)39)22-27-17-11-12-18-28(27)35(2)3/h4-18,29-30H,1,19-24H2,2-3H3,(H,34,42)/t29-,30+/m0/s1 |
| InChIKey | JQVDDHUYMDZTRQ-XZWHSSHBSA-N |
| XLogP | 3.49 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.71 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|