C33H36N6O4 — CID 89302093
1-[(5S,8aS)-7-[(4-methyl-2,3-dihydro-1,4-benzoxazin-5-yl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea (PubChem CID 89302093) has the molecular formula C33H36N6O4 and a molecular weight of 580.69 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(4-methyl-2,3-dihydro-1,4-benzoxazin-5-yl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea.
| Compound Name | 1-[(5S,8aS)-7-[(4-methyl-2,3-dihydro-1,4-benzoxazin-5-yl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89302093 |
| Molecular Formula | C33H36N6O4 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | 1-[(5S,8aS)-7-[(4-methyl-2,3-dihydro-1,4-benzoxazin-5-yl)methyl]-3,6-dioxo-5-phenyl-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](c3ccccc3)C(=O)N(Cc3cccc4c3N(C)CCO4)C[C@@H]21 |
| InChI | InChI=1S/C33H36N6O4/c1-3-17-37(33(42)34-20-24-11-6-4-7-12-24)38-23-29(40)39-28(38)22-36(32(41)31(39)25-13-8-5-9-14-25)21-26-15-10-16-27-30(26)35(2)18-19-43-27/h3-16,28,31H,1,17-23H2,2H3,(H,34,42)/t28-,31+/m1/s1 |
| InChIKey | XVMYNLYNVNTERY-MVSFAKPFSA-N |
| XLogP | 3.38 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|