C35H39ClN6O4 — CID 89305493
1-[(5S,8aS)-5-benzyl-7-[(3-chloro-2-morpholin-4-ylphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea (PubChem CID 89305493) has the molecular formula C35H39ClN6O4 and a molecular weight of 643.19 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-benzyl-7-[(3-chloro-2-morpholin-4-ylphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea.
| Compound Name | 1-[(5S,8aS)-5-benzyl-7-[(3-chloro-2-morpholin-4-ylphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89305493 |
| Molecular Formula | C35H39ClN6O4 |
| Molecular Weight | 643.19 g/mol |
| Exact Mass | 642.27 |
| IUPAC Name | 1-[(5S,8aS)-5-benzyl-7-[(3-chloro-2-morpholin-4-ylphenyl)methyl]-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](Cc3ccccc3)C(=O)N(Cc3cccc(Cl)c3N3CCOCC3)C[C@@H]21 |
| InChI | InChI=1S/C35H39ClN6O4/c1-2-16-40(35(45)37-22-27-12-7-4-8-13-27)41-25-32(43)42-30(21-26-10-5-3-6-11-26)34(44)39(24-31(41)42)23-28-14-9-15-29(36)33(28)38-17-19-46-20-18-38/h2-15,30-31H,1,16-25H2,(H,37,45)/t30-,31+/m0/s1 |
| InChIKey | ANDUBHWOCVMGMP-IOWSJCHKSA-N |
| XLogP | 3.91 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.19 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|