C37H33Cl2N5O4 — CID 89168616
1-[(5S,8aS)-5-(1-benzofuran-5-ylmethyl)-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-prop-2-enylurea (PubChem CID 89168616) has the molecular formula C37H33Cl2N5O4 and a molecular weight of 682.61 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-(1-benzofuran-5-ylmethyl)-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-prop-2-enylurea.
| Compound Name | 1-[(5S,8aS)-5-(1-benzofuran-5-ylmethyl)-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89168616 |
| Molecular Formula | C37H33Cl2N5O4 |
| Molecular Weight | 682.61 g/mol |
| Exact Mass | 681.19 |
| IUPAC Name | 1-[(5S,8aS)-5-(1-benzofuran-5-ylmethyl)-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccc(Cl)c(Cl)c1)N1CC(=O)N2[C@@H](Cc3ccc4occc4c3)C(=O)N(Cc3cccc4ccccc34)C[C@@H]21 |
| InChI | InChI=1S/C37H33Cl2N5O4/c1-2-15-42(37(47)40-20-25-10-12-30(38)31(39)18-25)43-23-35(45)44-32(19-24-11-13-33-27(17-24)14-16-48-33)36(46)41(22-34(43)44)21-28-8-5-7-26-6-3-4-9-29(26)28/h2-14,16-18,32,34H,1,15,19-23H2,(H,40,47)/t32-,34+/m0/s1 |
| InChIKey | JLYFQDBWRAFACV-UZNNEEJFSA-N |
| XLogP | 6.63 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.61 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|