C35H35Cl2N5O3 — CID 16725548
1-[(5S,8aS)-5-benzyl-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-propan-2-ylurea (PubChem CID 16725548) has the molecular formula C35H35Cl2N5O3 and a molecular weight of 644.60 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-benzyl-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-propan-2-ylurea.
| Compound Name | 1-[(5S,8aS)-5-benzyl-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-propan-2-ylurea |
|---|---|
| PubChem CID | 16725548 |
| Molecular Formula | C35H35Cl2N5O3 |
| Molecular Weight | 644.60 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | 1-[(5S,8aS)-5-benzyl-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-propan-2-ylurea |
| SMILES | CC(C)N(C(=O)NCc1ccc(Cl)c(Cl)c1)N1CC(=O)N2[C@@H](Cc3ccccc3)C(=O)N(Cc3cccc4ccccc34)C[C@@H]21 |
| InChI | InChI=1S/C35H35Cl2N5O3/c1-23(2)42(35(45)38-19-25-15-16-29(36)30(37)17-25)40-22-33(43)41-31(18-24-9-4-3-5-10-24)34(44)39(21-32(40)41)20-27-13-8-12-26-11-6-7-14-28(26)27/h3-17,23,31-32H,18-22H2,1-2H3,(H,38,45)/t31-,32+/m0/s1 |
| InChIKey | GDYYQYQAFZXXKU-AJQTZOPKSA-N |
| XLogP | 6.11 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.60 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |