C35H35Cl2N5O4 — CID 71189306
1-[(8aS)-5-[(4-hydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-propylurea (PubChem CID 71189306) has the molecular formula C35H35Cl2N5O4 and a molecular weight of 660.60 g/mol. Its IUPAC name is 1-[(8aS)-5-[(4-hydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-propylurea.
| Compound Name | 1-[(8aS)-5-[(4-hydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-propylurea |
|---|---|
| PubChem CID | 71189306 |
| Molecular Formula | C35H35Cl2N5O4 |
| Molecular Weight | 660.60 g/mol |
| Exact Mass | 659.21 |
| IUPAC Name | 1-[(8aS)-5-[(4-hydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(3,4-dichlorophenyl)methyl]-1-propylurea |
| SMILES | CCCN(C(=O)NCc1ccc(Cl)c(Cl)c1)N1CC(=O)N2C(Cc3ccc(O)cc3)C(=O)N(Cc3cccc4ccccc34)C[C@@H]21 |
| InChI | InChI=1S/C35H35Cl2N5O4/c1-2-16-40(35(46)38-19-24-12-15-29(36)30(37)17-24)41-22-33(44)42-31(18-23-10-13-27(43)14-11-23)34(45)39(21-32(41)42)20-26-8-5-7-25-6-3-4-9-28(25)26/h3-15,17,31-32,43H,2,16,18-22H2,1H3,(H,38,46)/t31?,32-/m1/s1 |
| InChIKey | MXIPMJPODYEGKO-IADGFXSZSA-N |
| XLogP | 5.81 |
| TPSA | 96.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.60 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |