C35H37FN6O3 — CID 89353630
1-[(5S,8aS)-5-[(4-aminophenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-propylurea (PubChem CID 89353630) has the molecular formula C35H37FN6O3 and a molecular weight of 608.72 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-[(4-aminophenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-propylurea.
| Compound Name | 1-[(5S,8aS)-5-[(4-aminophenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-propylurea |
|---|---|
| PubChem CID | 89353630 |
| Molecular Formula | C35H37FN6O3 |
| Molecular Weight | 608.72 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | 1-[(5S,8aS)-5-[(4-aminophenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-propylurea |
| SMILES | CCCN(C(=O)NCc1ccc(F)cc1)N1CC(=O)N2[C@@H](Cc3ccc(N)cc3)C(=O)N(Cc3cccc4ccccc34)C[C@@H]21 |
| InChI | InChI=1S/C35H37FN6O3/c1-2-18-40(35(45)38-20-25-10-14-28(36)15-11-25)41-23-33(43)42-31(19-24-12-16-29(37)17-13-24)34(44)39(22-32(41)42)21-27-8-5-7-26-6-3-4-9-30(26)27/h3-17,31-32H,2,18-23,37H2,1H3,(H,38,45)/t31-,32+/m0/s1 |
| InChIKey | JKKHPXRCOVCBMN-AJQTZOPKSA-N |
| XLogP | 4.52 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.72 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|