C35H34FN5O5 — CID 89168404
1-[(5S,8aS)-5-[(3,4-dihydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-prop-2-enylurea (PubChem CID 89168404) has the molecular formula C35H34FN5O5 and a molecular weight of 623.69 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-[(3,4-dihydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-prop-2-enylurea.
| Compound Name | 1-[(5S,8aS)-5-[(3,4-dihydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89168404 |
| Molecular Formula | C35H34FN5O5 |
| Molecular Weight | 623.69 g/mol |
| Exact Mass | 623.25 |
| IUPAC Name | 1-[(5S,8aS)-5-[(3,4-dihydroxyphenyl)methyl]-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-[(4-fluorophenyl)methyl]-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccc(F)cc1)N1CC(=O)N2[C@@H](Cc3ccc(O)c(O)c3)C(=O)N(Cc3cccc4ccccc34)C[C@@H]21 |
| InChI | InChI=1S/C35H34FN5O5/c1-2-16-39(35(46)37-19-23-10-13-27(36)14-11-23)40-22-33(44)41-29(17-24-12-15-30(42)31(43)18-24)34(45)38(21-32(40)41)20-26-8-5-7-25-6-3-4-9-28(25)26/h2-15,18,29,32,42-43H,1,16-17,19-22H2,(H,37,46)/t29-,32+/m0/s1 |
| InChIKey | GFLAOGUYYVNJPZ-BHDXBOSCSA-N |
| XLogP | 4.13 |
| TPSA | 116.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.69 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|