C34H34N6O4 — CID 89302258
1-[(5S,8aS)-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-7-(quinolin-5-ylmethyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea (PubChem CID 89302258) has the molecular formula C34H34N6O4 and a molecular weight of 590.68 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-7-(quinolin-5-ylmethyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea.
| Compound Name | 1-[(5S,8aS)-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-7-(quinolin-5-ylmethyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89302258 |
| Molecular Formula | C34H34N6O4 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | 1-[(5S,8aS)-5-[(4-hydroxyphenyl)methyl]-3,6-dioxo-7-(quinolin-5-ylmethyl)-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-benzyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCc1ccccc1)N1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3cccc4ncccc34)C[C@@H]21 |
| InChI | InChI=1S/C34H34N6O4/c1-2-18-38(34(44)36-20-25-8-4-3-5-9-25)39-23-32(42)40-30(19-24-13-15-27(41)16-14-24)33(43)37(22-31(39)40)21-26-10-6-12-29-28(26)11-7-17-35-29/h2-17,30-31,41H,1,18-23H2,(H,36,44)/t30-,31+/m0/s1 |
| InChIKey | HHPSJTRARDGMEA-IOWSJCHKSA-N |
| XLogP | 3.68 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|