C31H35N7O4S — CID 89168623
1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-(1-benzofuran-5-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-prop-2-enylurea (PubChem CID 89168623) has the molecular formula C31H35N7O4S and a molecular weight of 601.73 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-(1-benzofuran-5-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-prop-2-enylurea.
| Compound Name | 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-(1-benzofuran-5-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89168623 |
| Molecular Formula | C31H35N7O4S |
| Molecular Weight | 601.73 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-(1-benzofuran-5-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NCCCC)N1CC(=O)N2[C@@H](Cc3ccc4occc4c3)C(=O)N(Cc3cccc4sc(N)nc34)C[C@@H]21 |
| InChI | InChI=1S/C31H35N7O4S/c1-3-5-12-33-31(41)36(13-4-2)37-19-27(39)38-23(16-20-9-10-24-21(15-20)11-14-42-24)29(40)35(18-26(37)38)17-22-7-6-8-25-28(22)34-30(32)43-25/h4,6-11,14-15,23,26H,2-3,5,12-13,16-19H2,1H3,(H2,32,34)(H,33,41)/t23-,26+/m0/s1 |
| InChIKey | AMDCZRITCQFWAK-JYFHCDHNSA-N |
| XLogP | 3.96 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.73 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|