C31H31N5O4 — CID 89302247
1-[(5S,8aS)-5-(1-benzofuran-5-ylmethyl)-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-methyl-1-prop-2-enylurea (PubChem CID 89302247) has the molecular formula C31H31N5O4 and a molecular weight of 537.62 g/mol. Its IUPAC name is 1-[(5S,8aS)-5-(1-benzofuran-5-ylmethyl)-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-methyl-1-prop-2-enylurea.
| Compound Name | 1-[(5S,8aS)-5-(1-benzofuran-5-ylmethyl)-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-methyl-1-prop-2-enylurea |
|---|---|
| PubChem CID | 89302247 |
| Molecular Formula | C31H31N5O4 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 1-[(5S,8aS)-5-(1-benzofuran-5-ylmethyl)-7-(naphthalen-1-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-methyl-1-prop-2-enylurea |
| SMILES | C=CCN(C(=O)NC)N1CC(=O)N2[C@@H](Cc3ccc4occc4c3)C(=O)N(Cc3cccc4ccccc34)C[C@@H]21 |
| InChI | InChI=1S/C31H31N5O4/c1-3-14-34(31(39)32-2)35-20-29(37)36-26(17-21-11-12-27-23(16-21)13-15-40-27)30(38)33(19-28(35)36)18-24-9-6-8-22-7-4-5-10-25(22)24/h3-13,15-16,26,28H,1,14,17-20H2,2H3,(H,32,39)/t26-,28+/m0/s1 |
| InChIKey | USHYOVPKTIVASH-XTEPFMGCSA-N |
| XLogP | 3.75 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|