C30H37N9O3S — CID 118929576
1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-(1H-indazol-5-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-propylurea (PubChem CID 118929576) has the molecular formula C30H37N9O3S and a molecular weight of 603.75 g/mol. Its IUPAC name is 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-(1H-indazol-5-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-propylurea.
| Compound Name | 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-(1H-indazol-5-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-propylurea |
|---|---|
| PubChem CID | 118929576 |
| Molecular Formula | C30H37N9O3S |
| Molecular Weight | 603.75 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | 1-[(5S,8aS)-7-[(2-amino-1,3-benzothiazol-4-yl)methyl]-5-(1H-indazol-5-ylmethyl)-3,6-dioxo-2,5,8,8a-tetrahydroimidazo[1,2-a]pyrazin-1-yl]-3-butyl-1-propylurea |
| SMILES | CCCCNC(=O)N(CCC)N1CC(=O)N2[C@@H](Cc3ccc4[nH]ncc4c3)C(=O)N(Cc3cccc4sc(N)nc34)C[C@@H]21 |
| InChI | InChI=1S/C30H37N9O3S/c1-3-5-11-32-30(42)37(12-4-2)38-18-26(40)39-23(14-19-9-10-22-21(13-19)15-33-35-22)28(41)36(17-25(38)39)16-20-7-6-8-24-27(20)34-29(31)43-24/h6-10,13,15,23,25H,3-5,11-12,14,16-18H2,1-2H3,(H2,31,34)(H,32,42)(H,33,35)/t23-,25+/m0/s1 |
| InChIKey | BFBKGFYDEUWLOY-UKILVPOCSA-N |
| XLogP | 3.32 |
| TPSA | 143.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|